C20H16F3N5O3S — CID 58338034
N-[2-[3-methoxy-4-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]oxyphenyl]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 58338034) has the molecular formula C20H16F3N5O3S and a molecular weight of 463.44 g/mol. Its IUPAC name is N-[2-[3-methoxy-4-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]oxyphenyl]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | N-[2-[3-methoxy-4-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]oxyphenyl]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 58338034 |
| Molecular Formula | C20H16F3N5O3S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[2-[3-methoxy-4-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]oxyphenyl]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | COc1cc(CCNc2ncnc3scnc23)ccc1Oc1cc(C(F)(F)F)cc[n+]1[O-] |
| InChI | InChI=1S/C20H16F3N5O3S/c1-30-15-8-12(4-6-24-18-17-19(26-10-25-18)32-11-27-17)2-3-14(15)31-16-9-13(20(21,22)23)5-7-28(16)29/h2-3,5,7-11H,4,6H2,1H3,(H,24,25,26) |
| InChIKey | WYNPBHJMEQGQAL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|