C22H17ClF2N4O2 — CID 59223050
N-[2-[4-[(2-chloro-4-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine (PubChem CID 59223050) has the molecular formula C22H17ClF2N4O2 and a molecular weight of 442.85 g/mol. Its IUPAC name is N-[2-[4-[(2-chloro-4-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine.
| Compound Name | N-[2-[4-[(2-chloro-4-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 59223050 |
| Molecular Formula | C22H17ClF2N4O2 |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-[2-[4-[(2-chloro-4-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine |
| SMILES | COc1cc(CCNc2ncnc3c(F)ccc(F)c23)ccc1Oc1ccnc(Cl)c1 |
| InChI | InChI=1S/C22H17ClF2N4O2/c1-30-18-10-13(2-5-17(18)31-14-7-9-26-19(23)11-14)6-8-27-22-20-15(24)3-4-16(25)21(20)28-12-29-22/h2-5,7,9-12H,6,8H2,1H3,(H,27,28,29) |
| InChIKey | KVUKAGDLONGXOG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|