C21H15ClF2N4O — CID 59222987
N-[2-[4-[(2-chloro-4-pyridinyl)oxy]phenyl]ethyl]-5,8-difluoroquinazolin-4-amine (PubChem CID 59222987) has the molecular formula C21H15ClF2N4O and a molecular weight of 412.83 g/mol. Its IUPAC name is N-[2-[4-[(2-chloro-4-pyridinyl)oxy]phenyl]ethyl]-5,8-difluoroquinazolin-4-amine.
| Compound Name | N-[2-[4-[(2-chloro-4-pyridinyl)oxy]phenyl]ethyl]-5,8-difluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 59222987 |
| Molecular Formula | C21H15ClF2N4O |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[2-[4-[(2-chloro-4-pyridinyl)oxy]phenyl]ethyl]-5,8-difluoroquinazolin-4-amine |
| SMILES | Fc1ccc(F)c2c(NCCc3ccc(Oc4ccnc(Cl)c4)cc3)ncnc12 |
| InChI | InChI=1S/C21H15ClF2N4O/c22-18-11-15(8-10-25-18)29-14-3-1-13(2-4-14)7-9-26-21-19-16(23)5-6-17(24)20(19)27-12-28-21/h1-6,8,10-12H,7,9H2,(H,26,27,28) |
| InChIKey | DJURSTIDKGSTQU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|