C22H15F5N4O2 — CID 59223056
5,8-difluoro-N-[2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]quinazolin-4-amine (PubChem CID 59223056) has the molecular formula C22H15F5N4O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is 5,8-difluoro-N-[2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]quinazolin-4-amine.
| Compound Name | 5,8-difluoro-N-[2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 59223056 |
| Molecular Formula | C22H15F5N4O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 5,8-difluoro-N-[2-[4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]quinazolin-4-amine |
| SMILES | Fc1ccc(F)c2c(NCCOc3ccc(Oc4cc(C(F)(F)F)ccn4)cc3)ncnc12 |
| InChI | InChI=1S/C22H15F5N4O2/c23-16-5-6-17(24)20-19(16)21(31-12-30-20)29-9-10-32-14-1-3-15(4-2-14)33-18-11-13(7-8-28-18)22(25,26)27/h1-8,11-12H,9-10H2,(H,29,30,31) |
| InChIKey | YLPIGRPIQIFNBX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|