C22H16F5N5O2 — CID 59223067
N-[2-[4-[(4-amino-3,5,6-trifluoro-2-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine (PubChem CID 59223067) has the molecular formula C22H16F5N5O2 and a molecular weight of 477.39 g/mol. Its IUPAC name is N-[2-[4-[(4-amino-3,5,6-trifluoro-2-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine.
| Compound Name | N-[2-[4-[(4-amino-3,5,6-trifluoro-2-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 59223067 |
| Molecular Formula | C22H16F5N5O2 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[2-[4-[(4-amino-3,5,6-trifluoro-2-pyridinyl)oxy]-3-methoxyphenyl]ethyl]-5,8-difluoroquinazolin-4-amine |
| SMILES | COc1cc(CCNc2ncnc3c(F)ccc(F)c23)ccc1Oc1nc(F)c(F)c(N)c1F |
| InChI | InChI=1S/C22H16F5N5O2/c1-33-14-8-10(2-5-13(14)34-22-17(26)18(28)16(25)20(27)32-22)6-7-29-21-15-11(23)3-4-12(24)19(15)30-9-31-21/h2-5,8-9H,6-7H2,1H3,(H2,28,32)(H,29,30,31) |
| InChIKey | ZEQPYUICBRUKNG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|