C15H26N2O4 — CID 58338973
N-[2-[2-[2-[2-[bis(ethenyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-N-ethenylformamide (PubChem CID 58338973) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[bis(ethenyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-N-ethenylformamide.
| Compound Name | N-[2-[2-[2-[2-[bis(ethenyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-N-ethenylformamide |
|---|---|
| PubChem CID | 58338973 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-[2-[2-[2-[2-[bis(ethenyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-N-ethenylformamide |
| SMILES | C=CN(C=C)CCOCCOCCOCCN(C=C)C=O |
| InChI | InChI=1S/C15H26N2O4/c1-4-16(5-2)7-9-19-11-13-21-14-12-20-10-8-17(6-3)15-18/h4-6,15H,1-3,7-14H2 |
| InChIKey | SIBLOSQVUMWIPV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|