C14H24N2O4 — CID 58444868
N-[2-[2-[2-[acetyl(ethenyl)amino]ethoxy]ethoxy]ethyl]-N-ethenylacetamide (PubChem CID 58444868) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[2-[2-[2-[acetyl(ethenyl)amino]ethoxy]ethoxy]ethyl]-N-ethenylacetamide.
| Compound Name | N-[2-[2-[2-[acetyl(ethenyl)amino]ethoxy]ethoxy]ethyl]-N-ethenylacetamide |
|---|---|
| PubChem CID | 58444868 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-[2-[2-[2-[acetyl(ethenyl)amino]ethoxy]ethoxy]ethyl]-N-ethenylacetamide |
| SMILES | C=CN(CCOCCOCCN(C=C)C(C)=O)C(C)=O |
| InChI | InChI=1S/C14H24N2O4/c1-5-15(13(3)17)7-9-19-11-12-20-10-8-16(6-2)14(4)18/h5-6H,1-2,7-12H2,3-4H3 |
| InChIKey | HMXSICFQFJFMNR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|