C23H23BN2O4 — CID 58343949
[2-[(E)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]-4-(2-phenylethoxy)phenyl]boronic acid (PubChem CID 58343949) has the molecular formula C23H23BN2O4 and a molecular weight of 402.26 g/mol. Its IUPAC name is [2-[(E)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]-4-(2-phenylethoxy)phenyl]boronic acid.
| Compound Name | [2-[(E)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]-4-(2-phenylethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 58343949 |
| Molecular Formula | C23H23BN2O4 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [2-[(E)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]-4-(2-phenylethoxy)phenyl]boronic acid |
| SMILES | O=C(/C=C/c1cc(OCCc2ccccc2)ccc1B(O)O)NCc1cccnc1 |
| InChI | InChI=1S/C23H23BN2O4/c27-23(26-17-19-7-4-13-25-16-19)11-8-20-15-21(9-10-22(20)24(28)29)30-14-12-18-5-2-1-3-6-18/h1-11,13,15-16,28-29H,12,14,17H2,(H,26,27)/b11-8+ |
| InChIKey | HURBOLKQUXGLHU-DHZHZOJOSA-N |
| XLogP | 1.71 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|