C11H14N2O — CID 58344637
(1R)-N'-hydroxy-1-methyl-2,3-dihydro-1H-indene-4-carboximidamide (PubChem CID 58344637) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (1R)-N'-hydroxy-1-methyl-2,3-dihydro-1H-indene-4-carboximidamide.
| Compound Name | (1R)-N'-hydroxy-1-methyl-2,3-dihydro-1H-indene-4-carboximidamide |
|---|---|
| PubChem CID | 58344637 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (1R)-N'-hydroxy-1-methyl-2,3-dihydro-1H-indene-4-carboximidamide |
| SMILES | C[C@@H]1CCc2c(/C(N)=N\O)cccc21 |
| InChI | InChI=1S/C11H14N2O/c1-7-5-6-9-8(7)3-2-4-10(9)11(12)13-14/h2-4,7,14H,5-6H2,1H3,(H2,12,13)/t7-/m1/s1 |
| InChIKey | LCCIMJDYRZQYBT-SSDOTTSWSA-N |
| XLogP | 1.83 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|