C13H18O — CID 583459
1-(2,3,6-trimethylphenyl)butan-2-one (PubChem CID 583459) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(2,3,6-trimethylphenyl)butan-2-one.
| Compound Name | 1-(2,3,6-trimethylphenyl)butan-2-one |
|---|---|
| PubChem CID | 583459 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-(2,3,6-trimethylphenyl)butan-2-one |
| SMILES | CCC(=O)Cc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C13H18O/c1-5-12(14)8-13-10(3)7-6-9(2)11(13)4/h6-7H,5,8H2,1-4H3 |
| InChIKey | BWOLPMJHUMORCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |