C22H24F3NO — CID 58348248
1-[(4-methylphenyl)methyl]-4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]pyrrolidin-2-one (PubChem CID 58348248) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[(4-methylphenyl)methyl]-4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 58348248 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-4-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]pyrrolidin-2-one |
| SMILES | Cc1ccc(CN2CC(C(C)Cc3cccc(C(F)(F)F)c3)CC2=O)cc1 |
| InChI | InChI=1S/C22H24F3NO/c1-15-6-8-17(9-7-15)13-26-14-19(12-21(26)27)16(2)10-18-4-3-5-20(11-18)22(23,24)25/h3-9,11,16,19H,10,12-14H2,1-2H3 |
| InChIKey | JFWLLOMQTAEYKY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |