C34H33IrN3O4-2 — CID 58352533
3-(6-hydroxyhexoxy)pyridine-2-carboxylic acid;iridium;bis(2-phenylpyridine) (PubChem CID 58352533) has the molecular formula C34H33IrN3O4-2 and a molecular weight of 739.87 g/mol. Its IUPAC name is 3-(6-hydroxyhexoxy)pyridine-2-carboxylic acid;iridium;bis(2-phenylpyridine).
| Compound Name | 3-(6-hydroxyhexoxy)pyridine-2-carboxylic acid;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 58352533 |
| Molecular Formula | C34H33IrN3O4-2 |
| Molecular Weight | 739.87 g/mol |
| Exact Mass | 740.21 |
| IUPAC Name | 3-(6-hydroxyhexoxy)pyridine-2-carboxylic acid;iridium;bis(2-phenylpyridine) |
| SMILES | O=C(O)c1ncccc1OCCCCCCO.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C12H17NO4.2C11H8N.Ir/c14-8-3-1-2-4-9-17-10-6-5-7-13-11(10)12(15)16;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-7,14H,1-4,8-9H2,(H,15,16);2*1-6,8-9H;/q;2*-1; |
| InChIKey | QTPIVUWSOZIHLB-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.87 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|