C13H25N — CID 58352776
7,7-di(propan-2-yl)-3-azabicyclo[4.1.1]octane (PubChem CID 58352776) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 7,7-di(propan-2-yl)-3-azabicyclo[4.1.1]octane.
| Compound Name | 7,7-di(propan-2-yl)-3-azabicyclo[4.1.1]octane |
|---|---|
| PubChem CID | 58352776 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 7,7-di(propan-2-yl)-3-azabicyclo[4.1.1]octane |
| SMILES | CC(C)C1(C(C)C)C2CCNCC1C2 |
| InChI | InChI=1S/C13H25N/c1-9(2)13(10(3)4)11-5-6-14-8-12(13)7-11/h9-12,14H,5-8H2,1-4H3 |
| InChIKey | UDGZFMPJANMKIT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |