C30H46FN5O6 — CID 58355446
tert-butyl (3S,5R)-3-[[6-fluoro-1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]-5-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 58355446) has the molecular formula C30H46FN5O6 and a molecular weight of 591.73 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3-[[6-fluoro-1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]-5-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3-[[6-fluoro-1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]-5-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58355446 |
| Molecular Formula | C30H46FN5O6 |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | tert-butyl (3S,5R)-3-[[6-fluoro-1-(4-methoxybutyl)benzimidazole-2-carbonyl]-(2-methylpropyl)amino]-5-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | COCCCCn1c(C(=O)N(CC(C)C)[C@H]2C[C@@H](C(=O)N(C)OC)CN(C(=O)OC(C)(C)C)C2)nc2ccc(F)cc21 |
| InChI | InChI=1S/C30H46FN5O6/c1-20(2)17-36(23-15-21(27(37)33(6)41-8)18-34(19-23)29(39)42-30(3,4)5)28(38)26-32-24-12-11-22(31)16-25(24)35(26)13-9-10-14-40-7/h11-12,16,20-21,23H,9-10,13-15,17-19H2,1-8H3/t21-,23+/m1/s1 |
| InChIKey | RTPCQFBIYVADPM-GGAORHGYSA-N |
| XLogP | 4.35 |
| TPSA | 106.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|