C20H20N2O3S — CID 58356188
5-[benzenesulfonyl(methyl)amino]-N-cyclopropyl-1H-indene-2-carboxamide (PubChem CID 58356188) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-[benzenesulfonyl(methyl)amino]-N-cyclopropyl-1H-indene-2-carboxamide.
| Compound Name | 5-[benzenesulfonyl(methyl)amino]-N-cyclopropyl-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 58356188 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-[benzenesulfonyl(methyl)amino]-N-cyclopropyl-1H-indene-2-carboxamide |
| SMILES | CN(c1ccc2c(c1)C=C(C(=O)NC1CC1)C2)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-22(26(24,25)19-5-3-2-4-6-19)18-10-7-14-11-16(12-15(14)13-18)20(23)21-17-8-9-17/h2-7,10,12-13,17H,8-9,11H2,1H3,(H,21,23) |
| InChIKey | MVDPDBNGTHAAFX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |