C35H40N2O2 — CID 58356733
1-[3-[1-[[3-[2-(4-methylphenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxyphenyl]-4-pyrrolidin-1-ylbutan-1-one (PubChem CID 58356733) has the molecular formula C35H40N2O2 and a molecular weight of 520.72 g/mol. Its IUPAC name is 1-[3-[1-[[3-[2-(4-methylphenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxyphenyl]-4-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 1-[3-[1-[[3-[2-(4-methylphenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxyphenyl]-4-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 58356733 |
| Molecular Formula | C35H40N2O2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 1-[3-[1-[[3-[2-(4-methylphenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxyphenyl]-4-pyrrolidin-1-ylbutan-1-one |
| SMILES | Cc1ccc(C#Cc2cccc(CN3CCC(Oc4cccc(C(=O)CCCN5CCCC5)c4)CC3)c2)cc1 |
| InChI | InChI=1S/C35H40N2O2/c1-28-12-14-29(15-13-28)16-17-30-7-4-8-31(25-30)27-37-23-18-33(19-24-37)39-34-10-5-9-32(26-34)35(38)11-6-22-36-20-2-3-21-36/h4-5,7-10,12-15,25-26,33H,2-3,6,11,18-24,27H2,1H3 |
| InChIKey | DOAFWDKBNJPTFW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|