C31H34FN3O2 — CID 71170949
N-[2-(dimethylamino)ethyl]-3-[1-[[3-[2-(4-fluorophenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxybenzamide (PubChem CID 71170949) has the molecular formula C31H34FN3O2 and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[1-[[3-[2-(4-fluorophenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxybenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[1-[[3-[2-(4-fluorophenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 71170949 |
| Molecular Formula | C31H34FN3O2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[1-[[3-[2-(4-fluorophenyl)ethynyl]phenyl]methyl]piperidin-4-yl]oxybenzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(OC2CCN(Cc3cccc(C#Cc4ccc(F)cc4)c3)CC2)c1 |
| InChI | InChI=1S/C31H34FN3O2/c1-34(2)20-17-33-31(36)27-7-4-8-30(22-27)37-29-15-18-35(19-16-29)23-26-6-3-5-25(21-26)10-9-24-11-13-28(32)14-12-24/h3-8,11-14,21-22,29H,15-20,23H2,1-2H3,(H,33,36) |
| InChIKey | UKPZGSULFZFORA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|