C23H28N2O5 — CID 26330254
3-[1-(1,3-benzodioxol-4-ylmethyl)piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide (PubChem CID 26330254) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[1-(1,3-benzodioxol-4-ylmethyl)piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[1-(1,3-benzodioxol-4-ylmethyl)piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 26330254 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-[1-(1,3-benzodioxol-4-ylmethyl)piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(OC2CCN(Cc3cccc4c3OCO4)CC2)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-27-13-10-24-23(26)17-4-2-6-20(14-17)30-19-8-11-25(12-9-19)15-18-5-3-7-21-22(18)29-16-28-21/h2-7,14,19H,8-13,15-16H2,1H3,(H,24,26) |
| InChIKey | RMYDDXIGBIGUBX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|