C20H18ClF3N2 — CID 58360631
3-[(3S)-3-(3-chlorophenyl)butyl]-1-[4-(trifluoromethyl)phenyl]pyrazole (PubChem CID 58360631) has the molecular formula C20H18ClF3N2 and a molecular weight of 378.83 g/mol. Its IUPAC name is 3-[(3S)-3-(3-chlorophenyl)butyl]-1-[4-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 3-[(3S)-3-(3-chlorophenyl)butyl]-1-[4-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 58360631 |
| Molecular Formula | C20H18ClF3N2 |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-[(3S)-3-(3-chlorophenyl)butyl]-1-[4-(trifluoromethyl)phenyl]pyrazole |
| SMILES | C[C@@H](CCc1ccn(-c2ccc(C(F)(F)F)cc2)n1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18ClF3N2/c1-14(15-3-2-4-17(21)13-15)5-8-18-11-12-26(25-18)19-9-6-16(7-10-19)20(22,23)24/h2-4,6-7,9-14H,5,8H2,1H3/t14-/m0/s1 |
| InChIKey | LUHLVJJMXCCUTD-AWEZNQCLSA-N |
| XLogP | 6.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |