C27H33NO5S — CID 58363060
(11S,17R)-11,17-dihydroxy-10,13-dimethyl-N-[(S)-(4-methylphenyl)sulfinyl]-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 58363060) has the molecular formula C27H33NO5S and a molecular weight of 483.63 g/mol. Its IUPAC name is (11S,17R)-11,17-dihydroxy-10,13-dimethyl-N-[(S)-(4-methylphenyl)sulfinyl]-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (11S,17R)-11,17-dihydroxy-10,13-dimethyl-N-[(S)-(4-methylphenyl)sulfinyl]-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 58363060 |
| Molecular Formula | C27H33NO5S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | (11S,17R)-11,17-dihydroxy-10,13-dimethyl-N-[(S)-(4-methylphenyl)sulfinyl]-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | Cc1ccc([S@](=O)NC(=O)[C@@]2(O)CCC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC32C)cc1 |
| InChI | InChI=1S/C27H33NO5S/c1-16-4-7-19(8-5-16)34(33)28-24(31)27(32)13-11-21-20-9-6-17-14-18(29)10-12-25(17,2)23(20)22(30)15-26(21,27)3/h4-5,7-8,10,12,14,20-23,30,32H,6,9,11,13,15H2,1-3H3,(H,28,31)/t20?,21?,22?,23?,25?,26?,27-,34-/m0/s1 |
| InChIKey | NCLSHNXUKKZRJI-YVIQPMJCSA-N |
| XLogP | 3.14 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |