C19H33NO10 — CID 58363725
2-propoxyethyl 2-(ethylcarbamoyloxymethyl)-3-[2-(2-hydroxypropanoyloxy)propanoyloxy]-2-methylpropanoate (PubChem CID 58363725) has the molecular formula C19H33NO10 and a molecular weight of 435.47 g/mol. Its IUPAC name is 2-propoxyethyl 2-(ethylcarbamoyloxymethyl)-3-[2-(2-hydroxypropanoyloxy)propanoyloxy]-2-methylpropanoate.
| Compound Name | 2-propoxyethyl 2-(ethylcarbamoyloxymethyl)-3-[2-(2-hydroxypropanoyloxy)propanoyloxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 58363725 |
| Molecular Formula | C19H33NO10 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-propoxyethyl 2-(ethylcarbamoyloxymethyl)-3-[2-(2-hydroxypropanoyloxy)propanoyloxy]-2-methylpropanoate |
| SMILES | CCCOCCOC(=O)C(C)(COC(=O)NCC)COC(=O)C(C)OC(=O)C(C)O |
| InChI | InChI=1S/C19H33NO10/c1-6-8-26-9-10-27-17(24)19(5,12-29-18(25)20-7-2)11-28-16(23)14(4)30-15(22)13(3)21/h13-14,21H,6-12H2,1-5H3,(H,20,25) |
| InChIKey | YBVRTPGEBAZXTO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|