C19H19F2O6S- — CID 58364032
4-(6-butan-2-ylnaphthalene-2-carbonyl)oxy-1,1-difluoro-2-oxobutane-1-sulfonate (PubChem CID 58364032) has the molecular formula C19H19F2O6S- and a molecular weight of 413.42 g/mol. Its IUPAC name is 4-(6-butan-2-ylnaphthalene-2-carbonyl)oxy-1,1-difluoro-2-oxobutane-1-sulfonate.
| Compound Name | 4-(6-butan-2-ylnaphthalene-2-carbonyl)oxy-1,1-difluoro-2-oxobutane-1-sulfonate |
|---|---|
| PubChem CID | 58364032 |
| Molecular Formula | C19H19F2O6S- |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-(6-butan-2-ylnaphthalene-2-carbonyl)oxy-1,1-difluoro-2-oxobutane-1-sulfonate |
| SMILES | CCC(C)c1ccc2cc(C(=O)OCCC(=O)C(F)(F)S(=O)(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C19H20F2O6S/c1-3-12(2)13-4-5-15-11-16(7-6-14(15)10-13)18(23)27-9-8-17(22)19(20,21)28(24,25)26/h4-7,10-12H,3,8-9H2,1-2H3,(H,24,25,26)/p-1 |
| InChIKey | WXSNYOFSHUHFHP-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|