C35H42N2O9S — CID 58364428
[(1R,4R,6S,7Z,17R)-13-cyclopropyl-4-(2-cyclopropylsulfonylacetyl)-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carboxylate (PubChem CID 58364428) has the molecular formula C35H42N2O9S and a molecular weight of 666.79 g/mol. Its IUPAC name is [(1R,4R,6S,7Z,17R)-13-cyclopropyl-4-(2-cyclopropylsulfonylacetyl)-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carboxylate.
| Compound Name | [(1R,4R,6S,7Z,17R)-13-cyclopropyl-4-(2-cyclopropylsulfonylacetyl)-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carboxylate |
|---|---|
| PubChem CID | 58364428 |
| Molecular Formula | C35H42N2O9S |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [(1R,4R,6S,7Z,17R)-13-cyclopropyl-4-(2-cyclopropylsulfonylacetyl)-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-en-17-yl] 5,7-dihydro-[1,3]dioxolo[4,5-f]isoindole-6-carboxylate |
| SMILES | O=C1C[C@]2(C(=O)CS(=O)(=O)C3CC3)C[C@H]2/C=C\CCCCN(C2CC2)C(=O)C2C[C@H](OC(=O)N3Cc4cc5c(cc4C3)OCO5)C[C@@H]12 |
| InChI | InChI=1S/C35H42N2O9S/c38-29-16-35(32(39)19-47(42,43)26-8-9-26)15-23(35)5-3-1-2-4-10-37(24-6-7-24)33(40)28-14-25(13-27(28)29)46-34(41)36-17-21-11-30-31(45-20-44-30)12-22(21)18-36/h3,5,11-12,23-28H,1-2,4,6-10,13-20H2/b5-3-/t23-,25-,27-,28?,35-/m1/s1 |
| InChIKey | CHCLAYHVFIZAQL-FJJVQKMZSA-N |
| XLogP | 4.11 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|