C21H20N6OS — CID 58364702
N-[5-cyclohexyl-3-(5-isocyanofuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-3-methyl-1,2-thiazol-5-amine (PubChem CID 58364702) has the molecular formula C21H20N6OS and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[5-cyclohexyl-3-(5-isocyanofuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-3-methyl-1,2-thiazol-5-amine.
| Compound Name | N-[5-cyclohexyl-3-(5-isocyanofuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-3-methyl-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 58364702 |
| Molecular Formula | C21H20N6OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[5-cyclohexyl-3-(5-isocyanofuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-3-methyl-1,2-thiazol-5-amine |
| SMILES | [C-]#[N+]c1cc(-c2cnn3c(Nc4cc(C)ns4)cc(C4CCCCC4)nc23)co1 |
| InChI | InChI=1S/C21H20N6OS/c1-13-8-20(29-26-13)25-18-10-17(14-6-4-3-5-7-14)24-21-16(11-23-27(18)21)15-9-19(22-2)28-12-15/h8-12,14,25H,3-7H2,1H3 |
| InChIKey | ADMAKVSWUFMORK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 72.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|