C28H31F3N6O2 — CID 58366622
3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methyl-N-[3-(4-methylpentoxy)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 58366622) has the molecular formula C28H31F3N6O2 and a molecular weight of 540.59 g/mol. Its IUPAC name is 3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methyl-N-[3-(4-methylpentoxy)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methyl-N-[3-(4-methylpentoxy)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58366622 |
| Molecular Formula | C28H31F3N6O2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-4-methyl-N-[3-(4-methylpentoxy)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(OCCCC(C)C)cc(C(F)(F)F)c2)cc1-n1cc(-c2cnn(C)c2C)nn1 |
| InChI | InChI=1S/C28H31F3N6O2/c1-17(2)7-6-10-39-23-13-21(28(29,30)31)12-22(14-23)33-27(38)20-9-8-18(3)26(11-20)37-16-25(34-35-37)24-15-32-36(5)19(24)4/h8-9,11-17H,6-7,10H2,1-5H3,(H,33,38) |
| InChIKey | KDWKZMUNVVAXRU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|