About 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium
2-bromo-2H-imidazo[1,2-a]pyridin-4-ium (PubChem CID 58368928) has the molecular formula C7H6BrN2+
and a molecular weight of 198.04 g/mol. Its IUPAC name is 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium.
Molecular Properties
| Compound Name | 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium |
| PubChem CID | 58368928 |
| Molecular Formula | C7H6BrN2+ |
| Molecular Weight | 198.04 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium |
| SMILES | BrC1C=[n+]2ccccc2=N1 |
| InChI | InChI=1S/C7H6BrN2/c8-6-5-10-4-2-1-3-7(10)9-6/h1-6H/q+1 |
| InChIKey | TXQPKDSHFLRJEN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.04 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium?
The IUPAC name of 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium (CID 58368928) is 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium.
What is the SMILES notation for 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium?
The canonical SMILES for 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium is BrC1C=[n+]2ccccc2=N1.
What is the InChIKey of 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium?
The InChIKey is TXQPKDSHFLRJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN2/c8-6-5-10-4-2-1-3-7(10)9-6/h1-6H/q+1.
What are the key properties of 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium?
2-bromo-2H-imidazo[1,2-a]pyridin-4-ium has a molecular weight of 198.04 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2H-imidazo[1,2-a]pyridin-4-ium is sourced from PubChem (CID 58368928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).