C32H44N2O6 — CID 58369343
N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(6R)-2,6-dimethylpiperidin-1-yl]-1-hydroxypropan-2-yl]-7-(4-methoxyphenyl)-7-oxoheptanamide (PubChem CID 58369343) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(6R)-2,6-dimethylpiperidin-1-yl]-1-hydroxypropan-2-yl]-7-(4-methoxyphenyl)-7-oxoheptanamide.
| Compound Name | N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(6R)-2,6-dimethylpiperidin-1-yl]-1-hydroxypropan-2-yl]-7-(4-methoxyphenyl)-7-oxoheptanamide |
|---|---|
| PubChem CID | 58369343 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(6R)-2,6-dimethylpiperidin-1-yl]-1-hydroxypropan-2-yl]-7-(4-methoxyphenyl)-7-oxoheptanamide |
| SMILES | COc1ccc(C(=O)CCCCCC(=O)N[C@H](CN2C(C)CCC[C@H]2C)[C@@H](O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C32H44N2O6/c1-22-8-7-9-23(2)34(22)21-27(32(37)25-14-17-29-30(20-25)40-19-18-39-29)33-31(36)11-6-4-5-10-28(35)24-12-15-26(38-3)16-13-24/h12-17,20,22-23,27,32,37H,4-11,18-19,21H2,1-3H3,(H,33,36)/t22-,23?,27-,32+/m1/s1 |
| InChIKey | JEBIRQQCQDPPDX-CPIOBTSGSA-N |
| XLogP | 5.08 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|