C13H27NO5S — CID 58371391
2-[[2-(2,6-dimethylheptan-4-yloxy)-2-oxoethyl]amino]ethanesulfonic acid (PubChem CID 58371391) has the molecular formula C13H27NO5S and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethylheptan-4-yloxy)-2-oxoethyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-(2,6-dimethylheptan-4-yloxy)-2-oxoethyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 58371391 |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[[2-(2,6-dimethylheptan-4-yloxy)-2-oxoethyl]amino]ethanesulfonic acid |
| SMILES | CC(C)CC(CC(C)C)OC(=O)CNCCS(=O)(=O)O |
| InChI | InChI=1S/C13H27NO5S/c1-10(2)7-12(8-11(3)4)19-13(15)9-14-5-6-20(16,17)18/h10-12,14H,5-9H2,1-4H3,(H,16,17,18) |
| InChIKey | SOSIWSMEOJSJDT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|