2,6-dimethylheptan-4-yl hydrogen carbonate

C10H20O3 — CID 154411359

IUPAC2,6-dimethylheptan-4-yl hydrogen carbonate
SMILESCC(C)CC(CC(C)C)OC(=O)O
InChIInChI=1S/C10H20O3/c1-7(2)5-9(6-8(3)4)13-10(11)12/h7-9H,5-6H2,1-4H3,(H,11,12)
InChIKeyUSSXFEMYGNQUOG-UHFFFAOYSA-N
MW188.27 g/mol
LogP3.14
Rot. Bonds5

About 2,6-dimethylheptan-4-yl hydrogen carbonate

2,6-dimethylheptan-4-yl hydrogen carbonate (PubChem CID 154411359) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-yl hydrogen carbonate.

Molecular Properties

Compound Name2,6-dimethylheptan-4-yl hydrogen carbonate
PubChem CID154411359
Molecular FormulaC10H20O3
Molecular Weight188.27 g/mol
Exact Mass188.14
IUPAC Name2,6-dimethylheptan-4-yl hydrogen carbonate
SMILESCC(C)CC(CC(C)C)OC(=O)O
InChIInChI=1S/C10H20O3/c1-7(2)5-9(6-8(3)4)13-10(11)12/h7-9H,5-6H2,1-4H3,(H,11,12)
InChIKeyUSSXFEMYGNQUOG-UHFFFAOYSA-N
XLogP3.14
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 53.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,6-dimethylheptan-4-yl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethylheptan-4-yl hydrogen carbonate?
The IUPAC name of 2,6-dimethylheptan-4-yl hydrogen carbonate (CID 154411359) is 2,6-dimethylheptan-4-yl hydrogen carbonate.
What is the SMILES notation for 2,6-dimethylheptan-4-yl hydrogen carbonate?
The canonical SMILES for 2,6-dimethylheptan-4-yl hydrogen carbonate is CC(C)CC(CC(C)C)OC(=O)O.
What is the InChIKey of 2,6-dimethylheptan-4-yl hydrogen carbonate?
The InChIKey is USSXFEMYGNQUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-7(2)5-9(6-8(3)4)13-10(11)12/h7-9H,5-6H2,1-4H3,(H,11,12).
What are the key properties of 2,6-dimethylheptan-4-yl hydrogen carbonate?
2,6-dimethylheptan-4-yl hydrogen carbonate has a molecular weight of 188.27 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptan-4-yl hydrogen carbonate is sourced from PubChem (CID 154411359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).