C18H38O — CID 18359494
4-(2,6-dimethylheptan-4-yloxy)-2,6-dimethylheptane (PubChem CID 18359494) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is 4-(2,6-dimethylheptan-4-yloxy)-2,6-dimethylheptane.
| Compound Name | 4-(2,6-dimethylheptan-4-yloxy)-2,6-dimethylheptane |
|---|---|
| PubChem CID | 18359494 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 4-(2,6-dimethylheptan-4-yloxy)-2,6-dimethylheptane |
| SMILES | CC(C)CC(CC(C)C)OC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C18H38O/c1-13(2)9-17(10-14(3)4)19-18(11-15(5)6)12-16(7)8/h13-18H,9-12H2,1-8H3 |
| InChIKey | SYVDJRFFSYWOPC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |