C27H58O3Si — CID 175859767
tris(2,6-dimethylheptan-4-yloxy)silane (PubChem CID 175859767) has the molecular formula C27H58O3Si and a molecular weight of 458.84 g/mol. Its IUPAC name is tris(2,6-dimethylheptan-4-yloxy)silane.
| Compound Name | tris(2,6-dimethylheptan-4-yloxy)silane |
|---|---|
| PubChem CID | 175859767 |
| Molecular Formula | C27H58O3Si |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 458.42 |
| IUPAC Name | tris(2,6-dimethylheptan-4-yloxy)silane |
| SMILES | CC(C)CC(CC(C)C)O[SiH](OC(CC(C)C)CC(C)C)OC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C27H58O3Si/c1-19(2)13-25(14-20(3)4)28-31(29-26(15-21(5)6)16-22(7)8)30-27(17-23(9)10)18-24(11)12/h19-27,31H,13-18H2,1-12H3 |
| InChIKey | VCYCOXXSVRXCDN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|