C18H42NO3P3 — CID 151635571
4-methyl-N,N-bis(4-methyl-2-phosphanyloxypentyl)-2-phosphanyloxypentan-1-amine (PubChem CID 151635571) has the molecular formula C18H42NO3P3 and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-methyl-N,N-bis(4-methyl-2-phosphanyloxypentyl)-2-phosphanyloxypentan-1-amine.
| Compound Name | 4-methyl-N,N-bis(4-methyl-2-phosphanyloxypentyl)-2-phosphanyloxypentan-1-amine |
|---|---|
| PubChem CID | 151635571 |
| Molecular Formula | C18H42NO3P3 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-methyl-N,N-bis(4-methyl-2-phosphanyloxypentyl)-2-phosphanyloxypentan-1-amine |
| SMILES | CC(C)CC(CN(CC(CC(C)C)OP)CC(CC(C)C)OP)OP |
| InChI | InChI=1S/C18H42NO3P3/c1-13(2)7-16(20-23)10-19(11-17(21-24)8-14(3)4)12-18(22-25)9-15(5)6/h13-18H,7-12,23-25H2,1-6H3 |
| InChIKey | LPRAIRCXYYNZOV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|