About (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine
(2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine (PubChem CID 137384228) has the molecular formula C12H27NO3
and a molecular weight of 233.35 g/mol. Its IUPAC name is (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine.
Molecular Properties
| Compound Name | (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine |
| PubChem CID | 137384228 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine |
| SMILES | CO[C@H](C)CN(C[C@@H](C)OC)C[C@@H](C)OC |
| InChI | InChI=1S/C12H27NO3/c1-10(14-4)7-13(8-11(2)15-5)9-12(3)16-6/h10-12H,7-9H2,1-6H3/t10-,11-,12-/m1/s1 |
| InChIKey | VYACRIYBRCBMIA-IJLUTSLNSA-N |
| XLogP | 1.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine?
The IUPAC name of (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine (CID 137384228) is (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine.
What is the SMILES notation for (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine?
The canonical SMILES for (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine is CO[C@H](C)CN(C[C@@H](C)OC)C[C@@H](C)OC.
What is the InChIKey of (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine?
The InChIKey is VYACRIYBRCBMIA-IJLUTSLNSA-N. The full InChI is InChI=1S/C12H27NO3/c1-10(14-4)7-13(8-11(2)15-5)9-12(3)16-6/h10-12H,7-9H2,1-6H3/t10-,11-,12-/m1/s1.
What are the key properties of (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine?
(2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine has a molecular weight of 233.35 g/mol, XLogP of 1.39, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine is sourced from PubChem (CID 137384228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).