C12H27NO3 — CID 137384228
(2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine (PubChem CID 137384228) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine.
| Compound Name | (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine |
|---|---|
| PubChem CID | 137384228 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | (2R)-2-methoxy-N,N-bis[(2R)-2-methoxypropyl]propan-1-amine |
| SMILES | CO[C@H](C)CN(C[C@@H](C)OC)C[C@@H](C)OC |
| InChI | InChI=1S/C12H27NO3/c1-10(14-4)7-13(8-11(2)15-5)9-12(3)16-6/h10-12H,7-9H2,1-6H3/t10-,11-,12-/m1/s1 |
| InChIKey | VYACRIYBRCBMIA-IJLUTSLNSA-N |
| XLogP | 1.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |