C16H28N2O2 — CID 70177218
1-N,4-N-bis(2-methoxypropyl)-1-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 70177218) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-N,4-N-bis(2-methoxypropyl)-1-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(2-methoxypropyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70177218 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-N,4-N-bis(2-methoxypropyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | COC(C)CN(C)c1ccc(N(C)CC(C)OC)cc1 |
| InChI | InChI=1S/C16H28N2O2/c1-13(19-5)11-17(3)15-7-9-16(10-8-15)18(4)12-14(2)20-6/h7-10,13-14H,11-12H2,1-6H3 |
| InChIKey | QAEOIVXGANISKG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|