C11H16ClNO2 — CID 139970905
4-chloro-N-(2,2-dimethoxyethyl)-N-methylaniline (PubChem CID 139970905) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethoxyethyl)-N-methylaniline.
| Compound Name | 4-chloro-N-(2,2-dimethoxyethyl)-N-methylaniline |
|---|---|
| PubChem CID | 139970905 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-chloro-N-(2,2-dimethoxyethyl)-N-methylaniline |
| SMILES | COC(CN(C)c1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C11H16ClNO2/c1-13(8-11(14-2)15-3)10-6-4-9(12)5-7-10/h4-7,11H,8H2,1-3H3 |
| InChIKey | VVMHKJAHLOLFGD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|