C16H18ClN3O2 — CID 101494589
3-[4-[(4-chlorophenyl)diazenyl]-N-methylanilino]propane-1,2-diol (PubChem CID 101494589) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)diazenyl]-N-methylanilino]propane-1,2-diol.
| Compound Name | 3-[4-[(4-chlorophenyl)diazenyl]-N-methylanilino]propane-1,2-diol |
|---|---|
| PubChem CID | 101494589 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)diazenyl]-N-methylanilino]propane-1,2-diol |
| SMILES | CN(CC(O)CO)c1ccc(/N=N/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-20(10-16(22)11-21)15-8-6-14(7-9-15)19-18-13-4-2-12(17)3-5-13/h2-9,16,21-22H,10-11H2,1H3/b19-18+ |
| InChIKey | DFXXESBLDJWRIF-VHEBQXMUSA-N |
| XLogP | 3.54 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|