C12H17NO3 — CID 115122056
3-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]propane-1,2-diol (PubChem CID 115122056) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]propane-1,2-diol.
| Compound Name | 3-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 115122056 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]propane-1,2-diol |
| SMILES | CN(CC(O)CO)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H17NO3/c1-13(7-11(15)8-14)10-2-3-12-9(6-10)4-5-16-12/h2-3,6,11,14-15H,4-5,7-8H2,1H3 |
| InChIKey | STIKHGCADNLAPM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|