C11H12N2O — CID 115130911
2-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]acetonitrile (PubChem CID 115130911) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]acetonitrile.
| Compound Name | 2-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]acetonitrile |
|---|---|
| PubChem CID | 115130911 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-[2,3-dihydro-1-benzofuran-5-yl(methyl)amino]acetonitrile |
| SMILES | CN(CC#N)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H12N2O/c1-13(6-5-12)10-2-3-11-9(8-10)4-7-14-11/h2-3,8H,4,6-7H2,1H3 |
| InChIKey | UKLRAGMMLWOSSE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|