C10H10ClNO2 — CID 115194555
N-(2,3-dihydro-1-benzofuran-5-yl)-N-methylcarbamoyl chloride (PubChem CID 115194555) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-yl)-N-methylcarbamoyl chloride.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-yl)-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 115194555 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-yl)-N-methylcarbamoyl chloride |
| SMILES | CN(C(=O)Cl)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H10ClNO2/c1-12(10(11)13)8-2-3-9-7(6-8)4-5-14-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | SDGSGEOBWFINQT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|