C10H13N3O2 — CID 115192561
3-amino-1-(2,3-dihydro-1-benzofuran-5-yl)-1-methylurea (PubChem CID 115192561) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-amino-1-(2,3-dihydro-1-benzofuran-5-yl)-1-methylurea.
| Compound Name | 3-amino-1-(2,3-dihydro-1-benzofuran-5-yl)-1-methylurea |
|---|---|
| PubChem CID | 115192561 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-amino-1-(2,3-dihydro-1-benzofuran-5-yl)-1-methylurea |
| SMILES | CN(C(=O)NN)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H13N3O2/c1-13(10(14)12-11)8-2-3-9-7(6-8)4-5-15-9/h2-3,6H,4-5,11H2,1H3,(H,12,14) |
| InChIKey | JDKQLMNHRNLOJZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|