C11H15N3O3S — CID 115192560
3-amino-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1-methylurea (PubChem CID 115192560) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-amino-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1-methylurea.
| Compound Name | 3-amino-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1-methylurea |
|---|---|
| PubChem CID | 115192560 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-amino-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)-1-methylurea |
| SMILES | CN(C(=O)NN)c1ccc2c(c1)CCCS2(=O)=O |
| InChI | InChI=1S/C11H15N3O3S/c1-14(11(15)13-12)9-4-5-10-8(7-9)3-2-6-18(10,16)17/h4-5,7H,2-3,6,12H2,1H3,(H,13,15) |
| InChIKey | RVHNOQCDHOYCTI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|