C11H11ClO3S — CID 116917851
2-chloro-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)ethanone (PubChem CID 116917851) has the molecular formula C11H11ClO3S and a molecular weight of 258.73 g/mol. Its IUPAC name is 2-chloro-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)ethanone.
| Compound Name | 2-chloro-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)ethanone |
|---|---|
| PubChem CID | 116917851 |
| Molecular Formula | C11H11ClO3S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2-chloro-1-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)ethanone |
| SMILES | O=C(CCl)c1ccc2c(c1)CCCS2(=O)=O |
| InChI | InChI=1S/C11H11ClO3S/c12-7-10(13)8-3-4-11-9(6-8)2-1-5-16(11,14)15/h3-4,6H,1-2,5,7H2 |
| InChIKey | JDXGCNXXOGBMPF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|