C10H11NO3S2 — CID 115169744
(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)carbamothioic S-acid (PubChem CID 115169744) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)carbamothioic S-acid.
| Compound Name | (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)carbamothioic S-acid |
|---|---|
| PubChem CID | 115169744 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | (1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)carbamothioic S-acid |
| SMILES | O=C(S)Nc1ccc2c(c1)CCCS2(=O)=O |
| InChI | InChI=1S/C10H11NO3S2/c12-10(15)11-8-3-4-9-7(6-8)2-1-5-16(9,13)14/h3-4,6H,1-2,5H2,(H2,11,12,15) |
| InChIKey | ZVOYPXPTJOEJAG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|