C10H15N3O — CID 115260679
N-(hydrazinylmethyl)-N-methyl-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 115260679) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(hydrazinylmethyl)-N-methyl-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-(hydrazinylmethyl)-N-methyl-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 115260679 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-(hydrazinylmethyl)-N-methyl-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | CN(CNN)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H15N3O/c1-13(7-12-11)9-2-3-10-8(6-9)4-5-14-10/h2-3,6,12H,4-5,7,11H2,1H3 |
| InChIKey | XAUIQGCAFRAWGG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|