C17H20N2O — CID 115212433
N-[(4-aminophenyl)methyl]-N-methyl-3,4-dihydro-2H-chromen-6-amine (PubChem CID 115212433) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-methyl-3,4-dihydro-2H-chromen-6-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-N-methyl-3,4-dihydro-2H-chromen-6-amine |
|---|---|
| PubChem CID | 115212433 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-methyl-3,4-dihydro-2H-chromen-6-amine |
| SMILES | CN(Cc1ccc(N)cc1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C17H20N2O/c1-19(12-13-4-6-15(18)7-5-13)16-8-9-17-14(11-16)3-2-10-20-17/h4-9,11H,2-3,10,12,18H2,1H3 |
| InChIKey | MAPDDAGYBJMJJG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|