2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid

C12H13NO4 — CID 115141251

IUPAC2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid
SMILESCN(C(=O)C(=O)O)c1ccc2c(c1)CCCO2
InChIInChI=1S/C12H13NO4/c1-13(11(14)12(15)16)9-4-5-10-8(7-9)3-2-6-17-10/h4-5,7H,2-3,6H2,1H3,(H,15,16)
InChIKeySOAKQOWSDXIQPL-UHFFFAOYSA-N
MW235.24 g/mol
LogP1.06
Rot. Bonds1

About 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid

2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid (PubChem CID 115141251) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid.

Molecular Properties

Compound Name2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid
PubChem CID115141251
Molecular FormulaC12H13NO4
Molecular Weight235.24 g/mol
Exact Mass235.08
IUPAC Name2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid
SMILESCN(C(=O)C(=O)O)c1ccc2c(c1)CCCO2
InChIInChI=1S/C12H13NO4/c1-13(11(14)12(15)16)9-4-5-10-8(7-9)3-2-6-17-10/h4-5,7H,2-3,6H2,1H3,(H,15,16)
InChIKeySOAKQOWSDXIQPL-UHFFFAOYSA-N
XLogP1.06
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid?
The IUPAC name of 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid (CID 115141251) is 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid.
What is the SMILES notation for 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid?
The canonical SMILES for 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid is CN(C(=O)C(=O)O)c1ccc2c(c1)CCCO2.
What is the InChIKey of 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid?
The InChIKey is SOAKQOWSDXIQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-13(11(14)12(15)16)9-4-5-10-8(7-9)3-2-6-17-10/h4-5,7H,2-3,6H2,1H3,(H,15,16).
What are the key properties of 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid?
2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid has a molecular weight of 235.24 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-dihydro-2H-chromen-6-yl(methyl)amino]-2-oxoacetic acid is sourced from PubChem (CID 115141251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).