C11H17ClN2O — CID 105486100
N'-(4-chlorophenyl)-2-methoxy-N'-methylpropane-1,3-diamine (PubChem CID 105486100) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-2-methoxy-N'-methylpropane-1,3-diamine.
| Compound Name | N'-(4-chlorophenyl)-2-methoxy-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 105486100 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N'-(4-chlorophenyl)-2-methoxy-N'-methylpropane-1,3-diamine |
| SMILES | COC(CN)CN(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H17ClN2O/c1-14(8-11(7-13)15-2)10-5-3-9(12)4-6-10/h3-6,11H,7-8,13H2,1-2H3 |
| InChIKey | JLEMYWJCIJXWGJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |