C19H23Cl3N2O2 — CID 120593768
4-amino-N-[bis(4-chlorophenyl)methyl]-3-methoxy-N-methylbutanamide;hydrochloride (PubChem CID 120593768) has the molecular formula C19H23Cl3N2O2 and a molecular weight of 417.76 g/mol. Its IUPAC name is 4-amino-N-[bis(4-chlorophenyl)methyl]-3-methoxy-N-methylbutanamide;hydrochloride.
| Compound Name | 4-amino-N-[bis(4-chlorophenyl)methyl]-3-methoxy-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120593768 |
| Molecular Formula | C19H23Cl3N2O2 |
| Molecular Weight | 417.76 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-amino-N-[bis(4-chlorophenyl)methyl]-3-methoxy-N-methylbutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)N(C)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C19H22Cl2N2O2.ClH/c1-23(18(24)11-17(12-22)25-2)19(13-3-7-15(20)8-4-13)14-5-9-16(21)10-6-14;/h3-10,17,19H,11-12,22H2,1-2H3;1H |
| InChIKey | WMLXEEPPNAYOIH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |