C16H27ClN2O2 — CID 120590068
4-amino-N-(4-tert-butylphenyl)-3-methoxy-N-methylbutanamide;hydrochloride (PubChem CID 120590068) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 4-amino-N-(4-tert-butylphenyl)-3-methoxy-N-methylbutanamide;hydrochloride.
| Compound Name | 4-amino-N-(4-tert-butylphenyl)-3-methoxy-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120590068 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-amino-N-(4-tert-butylphenyl)-3-methoxy-N-methylbutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)N(C)c1ccc(C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-16(2,3)12-6-8-13(9-7-12)18(4)15(19)10-14(11-17)20-5;/h6-9,14H,10-11,17H2,1-5H3;1H |
| InChIKey | VYNJWZLJCXPCOT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |