About N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine
N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine (PubChem CID 172573724) has the molecular formula C8H17F2NO
and a molecular weight of 181.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine.
Analyze N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine?
The IUPAC name of N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine (CID 172573724) is N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine.
What is the SMILES notation for N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine?
The canonical SMILES for N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine is CCN(CC(F)F)CC(C)OC.
What is the InChIKey of N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine?
The InChIKey is OMELPRAUZCOTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2NO/c1-4-11(6-8(9)10)5-7(2)12-3/h7-8H,4-6H2,1-3H3.
What are the key properties of N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine?
N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine has a molecular weight of 181.23 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-N-ethyl-2-methoxypropan-1-amine is sourced from PubChem (CID 172573724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).